Name | D-Dimethyl tartrate |
Synonyms | D-Dimethyl tartrate DIMETHYL D-TARTRATE (-)-Dimethyl D-tartrate Meso-tartaric acid dimethyl ester D-(-)-Tartaric acid dimethyl ester dimethyl 2,3-dihydroxybutanedioate Meso-tartaric acid, dimethyl ester dimethyl (2R,3R)-2,3-dihydroxybutanedioate DIMETHYL (2S,3S)-2,3-DIHYDROXYBUTANEDIOATE Butanedioic acid, 2,3-dihydroxy-, dimethyl ester, (R*,S*)- |
CAS | 5057-96-5 13171-64-7 |
EINECS | 236-118-6 |
InChI | InChI=1/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4+ |
Molecular Formula | C6H10O6 |
Molar Mass | 178.14 |
Density | 1.367g/cm3 |
Melting Point | 48-50℃ |
Boling Point | 280°C at 760 mmHg |
Flash Point | 95.7°C |
Vapor Presure | 0.000467mmHg at 25°C |
pKa | 11.44±0.20(Predicted) |
Storage Condition | Inert atmosphere,Room Temperature |
Refractive Index | 1.47 |
Physical and Chemical Properties | Melting Point 48-50°C boiling point 157-159°C (11 mmHg) specific rotation -21 ° (C = 10, H2O) |
Use | Uses are mainly used in the synthesis of chiral drugs, chiral intermediates and asymmetric catalysis |
Hazard Symbols | Xi - Irritant![]() |
Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
Safety Description | S24/25 - Avoid contact with skin and eyes. |
WGK Germany | 3 |
HS Code | 29181300 |
Raw Materials | (+)-Dimethyl L-tartrate Methanol Trimethoxymethane Dimethyl fumarate D-Tartaric acid Dimethyl maleate |
Downstream Products | 2-Butenoic acid, 4-hydroxy-2-methyl-, methyl ester, (2E)- |
specific rotation | -21 ° (c=10, H2O) |
optical rotation (optical activity) | [α]20/D 21°, c = 2.5 in H2O |
BRN | 1726254 |
NIST chemical information | (-)-Dimethyl D-tartrate(13171-64-7) |